C18H21N5O2S — CID 25271135
3-(2-hydroxyethyl)-N,N,4-trimethyl-2-(4-pyrazol-1-ylphenyl)imino-1,3-thiazole-5-carboxamide (PubChem CID 25271135) has the molecular formula C18H21N5O2S and a molecular weight of 371.47 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-N,N,4-trimethyl-2-(4-pyrazol-1-ylphenyl)imino-1,3-thiazole-5-carboxamide.
| Compound Name | 3-(2-hydroxyethyl)-N,N,4-trimethyl-2-(4-pyrazol-1-ylphenyl)imino-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 25271135 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-(2-hydroxyethyl)-N,N,4-trimethyl-2-(4-pyrazol-1-ylphenyl)imino-1,3-thiazole-5-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C)s/c(=N/c2ccc(-n3cccn3)cc2)n1CCO |
| InChI | InChI=1S/C18H21N5O2S/c1-13-16(17(25)21(2)3)26-18(22(13)11-12-24)20-14-5-7-15(8-6-14)23-10-4-9-19-23/h4-10,24H,11-12H2,1-3H3/b20-18+ |
| InChIKey | VQZSUKNUJXKWOA-CZIZESTLSA-N |
| XLogP | 1.97 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|