About 4-pyrazol-1-ylbenzoate
4-pyrazol-1-ylbenzoate (PubChem CID 5158283) has the molecular formula C10H7N2O2-
and a molecular weight of 187.18 g/mol. Its IUPAC name is 4-pyrazol-1-ylbenzoate.
Molecular Properties
| Compound Name | 4-pyrazol-1-ylbenzoate |
| PubChem CID | 5158283 |
| Molecular Formula | C10H7N2O2- |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 4-pyrazol-1-ylbenzoate |
| SMILES | O=C([O-])c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C10H8N2O2/c13-10(14)8-2-4-9(5-3-8)12-7-1-6-11-12/h1-7H,(H,13,14)/p-1 |
| InChIKey | XOEKYPIBVOGCDG-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-pyrazol-1-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrazol-1-ylbenzoate?
The IUPAC name of 4-pyrazol-1-ylbenzoate (CID 5158283) is 4-pyrazol-1-ylbenzoate.
What is the SMILES notation for 4-pyrazol-1-ylbenzoate?
The canonical SMILES for 4-pyrazol-1-ylbenzoate is O=C([O-])c1ccc(-n2cccn2)cc1.
What is the InChIKey of 4-pyrazol-1-ylbenzoate?
The InChIKey is XOEKYPIBVOGCDG-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H8N2O2/c13-10(14)8-2-4-9(5-3-8)12-7-1-6-11-12/h1-7H,(H,13,14)/p-1.
What are the key properties of 4-pyrazol-1-ylbenzoate?
4-pyrazol-1-ylbenzoate has a molecular weight of 187.18 g/mol, XLogP of 0.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrazol-1-ylbenzoate is sourced from PubChem (CID 5158283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).