About 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride
1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride (PubChem CID 45135180) has the molecular formula C18H25ClN4OS
and a molecular weight of 380.95 g/mol. Its IUPAC name is 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride.
Molecular Properties
| Compound Name | 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride |
| PubChem CID | 45135180 |
| Molecular Formula | C18H25ClN4OS |
| Molecular Weight | 380.95 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride |
| SMILES | CC(=O)c1s/c(=N\c2ccccc2)n(CCN2CCNCC2)c1C.Cl |
| InChI | InChI=1S/C18H24N4OS.ClH/c1-14-17(15(2)23)24-18(20-16-6-4-3-5-7-16)22(14)13-12-21-10-8-19-9-11-21;/h3-7,19H,8-13H2,1-2H3;1H/b20-18-; |
| InChIKey | BAPVILLQYQPCCV-GQQUDWLYSA-N |
| XLogP | 2.62 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.95 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride?
The IUPAC name of 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride (CID 45135180) is 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride.
What is the SMILES notation for 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride?
The canonical SMILES for 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride is CC(=O)c1s/c(=N\c2ccccc2)n(CCN2CCNCC2)c1C.Cl.
What is the InChIKey of 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride?
The InChIKey is BAPVILLQYQPCCV-GQQUDWLYSA-N. The full InChI is InChI=1S/C18H24N4OS.ClH/c1-14-17(15(2)23)24-18(20-16-6-4-3-5-7-16)22(14)13-12-21-10-8-19-9-11-21;/h3-7,19H,8-13H2,1-2H3;1H/b20-18-;.
What are the key properties of 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride?
1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride has a molecular weight of 380.95 g/mol, XLogP of 2.62, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride is sourced from PubChem (CID 45135180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).