C18H25ClN4OS — CID 45135180
1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride (PubChem CID 45135180) has the molecular formula C18H25ClN4OS and a molecular weight of 380.95 g/mol. Its IUPAC name is 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride.
| Compound Name | 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 45135180 |
| Molecular Formula | C18H25ClN4OS |
| Molecular Weight | 380.95 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[4-methyl-2-phenylimino-3-(2-piperazin-1-ylethyl)-1,3-thiazol-5-yl]ethanone;hydrochloride |
| SMILES | CC(=O)c1s/c(=N\c2ccccc2)n(CCN2CCNCC2)c1C.Cl |
| InChI | InChI=1S/C18H24N4OS.ClH/c1-14-17(15(2)23)24-18(20-16-6-4-3-5-7-16)22(14)13-12-21-10-8-19-9-11-21;/h3-7,19H,8-13H2,1-2H3;1H/b20-18-; |
| InChIKey | BAPVILLQYQPCCV-GQQUDWLYSA-N |
| XLogP | 2.62 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.95 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|