C19H18N2O2S — CID 102501750
methyl 3-benzyl-4-methyl-2-phenylimino-1,3-thiazole-5-carboxylate (PubChem CID 102501750) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is methyl 3-benzyl-4-methyl-2-phenylimino-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 3-benzyl-4-methyl-2-phenylimino-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 102501750 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | methyl 3-benzyl-4-methyl-2-phenylimino-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1s/c(=N\c2ccccc2)n(Cc2ccccc2)c1C |
| InChI | InChI=1S/C19H18N2O2S/c1-14-17(18(22)23-2)24-19(20-16-11-7-4-8-12-16)21(14)13-15-9-5-3-6-10-15/h3-12H,13H2,1-2H3/b20-19- |
| InChIKey | SUJLDYXZFHUMLB-VXPUYCOJSA-N |
| XLogP | 3.93 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|