C15H13N3S2 — CID 23990120
3-prop-2-enyl-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23990120) has the molecular formula C15H13N3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 3-prop-2-enyl-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | 3-prop-2-enyl-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23990120 |
| Molecular Formula | C15H13N3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-prop-2-enyl-N-pyridin-3-yl-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | C=CCn1c(-c2cccs2)cs/c1=N\c1cccnc1 |
| InChI | InChI=1S/C15H13N3S2/c1-2-8-18-13(14-6-4-9-19-14)11-20-15(18)17-12-5-3-7-16-10-12/h2-7,9-11H,1,8H2/b17-15- |
| InChIKey | LNUYTTRFRJDOJW-ICFOKQHNSA-N |
| XLogP | 4.09 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|