C25H19N5S — CID 23958813
4-naphthalen-1-yl-N-pyridin-3-yl-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-2-imine (PubChem CID 23958813) has the molecular formula C25H19N5S and a molecular weight of 421.53 g/mol. Its IUPAC name is 4-naphthalen-1-yl-N-pyridin-3-yl-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | 4-naphthalen-1-yl-N-pyridin-3-yl-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23958813 |
| Molecular Formula | C25H19N5S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 4-naphthalen-1-yl-N-pyridin-3-yl-3-(1-pyridin-3-ylethylideneamino)-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2cccc3ccccc23)cs/c1=N\c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C25H19N5S/c1-18(20-9-5-13-26-15-20)29-30-24(17-31-25(30)28-21-10-6-14-27-16-21)23-12-4-8-19-7-2-3-11-22(19)23/h2-17H,1H3/b28-25-,29-18? |
| InChIKey | BQVYMQPXDWIDIC-LHHBJSLKSA-N |
| XLogP | 5.66 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|