C22H20N4S2 — CID 23935653
N-(2,4-dimethylphenyl)-3-(1-pyridin-3-ylethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23935653) has the molecular formula C22H20N4S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-(1-pyridin-3-ylethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(2,4-dimethylphenyl)-3-(1-pyridin-3-ylethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23935653 |
| Molecular Formula | C22H20N4S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-(1-pyridin-3-ylethylideneamino)-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2cccs2)cs/c1=N\c1ccc(C)cc1C)c1cccnc1 |
| InChI | InChI=1S/C22H20N4S2/c1-15-8-9-19(16(2)12-15)24-22-26(20(14-28-22)21-7-5-11-27-21)25-17(3)18-6-4-10-23-13-18/h4-14H,1-3H3/b24-22-,25-17? |
| InChIKey | PCKSRLLJHWIWEB-UXKGWEFQSA-N |
| XLogP | 5.79 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|