C28H24N6O2S — CID 23962658
3-[1-(4-imidazol-1-ylphenyl)ethylideneamino]-4-(3-nitrophenyl)-N-(2-phenylethyl)-1,3-thiazol-2-imine (PubChem CID 23962658) has the molecular formula C28H24N6O2S and a molecular weight of 508.61 g/mol. Its IUPAC name is 3-[1-(4-imidazol-1-ylphenyl)ethylideneamino]-4-(3-nitrophenyl)-N-(2-phenylethyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[1-(4-imidazol-1-ylphenyl)ethylideneamino]-4-(3-nitrophenyl)-N-(2-phenylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23962658 |
| Molecular Formula | C28H24N6O2S |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 3-[1-(4-imidazol-1-ylphenyl)ethylideneamino]-4-(3-nitrophenyl)-N-(2-phenylethyl)-1,3-thiazol-2-imine |
| SMILES | CC(=Nn1c(-c2cccc([N+](=O)[O-])c2)cs/c1=N\CCc1ccccc1)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C28H24N6O2S/c1-21(23-10-12-25(13-11-23)32-17-16-29-20-32)31-33-27(24-8-5-9-26(18-24)34(35)36)19-37-28(33)30-15-14-22-6-3-2-4-7-22/h2-13,16-20H,14-15H2,1H3/b30-28-,31-21? |
| InChIKey | YCJXXTIMIVCXJV-OUHOPPAUSA-N |
| XLogP | 5.73 |
| TPSA | 90.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|