C26H28N6O3S — CID 23765871
1,5-dimethyl-4-[[3-(4-methylpentan-2-ylideneamino)-4-(3-nitrophenyl)-1,3-thiazol-2-ylidene]amino]-2-phenylpyrazol-3-one (PubChem CID 23765871) has the molecular formula C26H28N6O3S and a molecular weight of 504.62 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[3-(4-methylpentan-2-ylideneamino)-4-(3-nitrophenyl)-1,3-thiazol-2-ylidene]amino]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[[3-(4-methylpentan-2-ylideneamino)-4-(3-nitrophenyl)-1,3-thiazol-2-ylidene]amino]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23765871 |
| Molecular Formula | C26H28N6O3S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 1,5-dimethyl-4-[[3-(4-methylpentan-2-ylideneamino)-4-(3-nitrophenyl)-1,3-thiazol-2-ylidene]amino]-2-phenylpyrazol-3-one |
| SMILES | CC(CC(C)C)=Nn1c(-c2cccc([N+](=O)[O-])c2)cs/c1=N\c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C26H28N6O3S/c1-17(2)14-18(3)28-30-23(20-10-9-13-22(15-20)32(34)35)16-36-26(30)27-24-19(4)29(5)31(25(24)33)21-11-7-6-8-12-21/h6-13,15-17H,14H2,1-5H3/b27-26-,28-18? |
| InChIKey | FLAKSPKXERKCHS-MZUIZAGRSA-N |
| XLogP | 5.43 |
| TPSA | 99.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|