C16H15N3O2S — CID 23907790
4-(furan-2-yl)-3-(furan-2-ylmethylideneamino)-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine (PubChem CID 23907790) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-(furan-2-yl)-3-(furan-2-ylmethylideneamino)-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(furan-2-yl)-3-(furan-2-ylmethylideneamino)-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23907790 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-(furan-2-yl)-3-(furan-2-ylmethylideneamino)-N-(2-methylprop-2-enyl)-1,3-thiazol-2-imine |
| SMILES | C=C(C)C/N=c1\scc(-c2ccco2)n1N=Cc1ccco1 |
| InChI | InChI=1S/C16H15N3O2S/c1-12(2)9-17-16-19(18-10-13-5-3-7-20-13)14(11-22-16)15-6-4-8-21-15/h3-8,10-11H,1,9H2,2H3/b17-16-,18-10? |
| InChIKey | AGZARTYKTKFMQY-OBGCEDAVSA-N |
| XLogP | 3.76 |
| TPSA | 55.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|