C25H18BrClN4S — CID 2620756
3-[(5-bromo-1H-indol-3-yl)methylideneamino]-4-(3-chlorophenyl)-N-(2-methylphenyl)-1,3-thiazol-2-imine (PubChem CID 2620756) has the molecular formula C25H18BrClN4S and a molecular weight of 521.87 g/mol. Its IUPAC name is 3-[(5-bromo-1H-indol-3-yl)methylideneamino]-4-(3-chlorophenyl)-N-(2-methylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-[(5-bromo-1H-indol-3-yl)methylideneamino]-4-(3-chlorophenyl)-N-(2-methylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2620756 |
| Molecular Formula | C25H18BrClN4S |
| Molecular Weight | 521.87 g/mol |
| Exact Mass | 520.01 |
| IUPAC Name | 3-[(5-bromo-1H-indol-3-yl)methylideneamino]-4-(3-chlorophenyl)-N-(2-methylphenyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccccc1/N=c1\scc(-c2cccc(Cl)c2)n1N=Cc1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C25H18BrClN4S/c1-16-5-2-3-8-22(16)30-25-31(24(15-32-25)17-6-4-7-20(27)11-17)29-14-18-13-28-23-10-9-19(26)12-21(18)23/h2-15,28H,1H3/b29-14?,30-25- |
| InChIKey | ZALWLXWENJNAMJ-GKKZVXLQSA-N |
| XLogP | 7.54 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.87 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|