C26H27N3O3S — CID 23937864
3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-4-(2,5-dimethoxyphenyl)-N-(2-methoxyphenyl)-1,3-thiazol-2-imine (PubChem CID 23937864) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-4-(2,5-dimethoxyphenyl)-N-(2-methoxyphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-4-(2,5-dimethoxyphenyl)-N-(2-methoxyphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23937864 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-4-(2,5-dimethoxyphenyl)-N-(2-methoxyphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3ccccc3OC)n2N=CC2CC3C=CC2C3)c1 |
| InChI | InChI=1S/C26H27N3O3S/c1-30-20-10-11-24(31-2)21(14-20)23-16-33-26(28-22-6-4-5-7-25(22)32-3)29(23)27-15-19-13-17-8-9-18(19)12-17/h4-11,14-19H,12-13H2,1-3H3/b27-15?,28-26- |
| InChIKey | UYHBTXGKJPREEB-GRWOMATHSA-N |
| XLogP | 5.52 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|