C21H21N3OS — CID 23798097
4-(1-benzofuran-2-yl)-3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-N-ethyl-1,3-thiazol-2-imine (PubChem CID 23798097) has the molecular formula C21H21N3OS and a molecular weight of 363.49 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-N-ethyl-1,3-thiazol-2-imine.
| Compound Name | 4-(1-benzofuran-2-yl)-3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-N-ethyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23798097 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3-(2-bicyclo[2.2.1]hept-5-enylmethylideneamino)-N-ethyl-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2cc3ccccc3o2)n1N=CC1CC2C=CC1C2 |
| InChI | InChI=1S/C21H21N3OS/c1-2-22-21-24(23-12-17-10-14-7-8-15(17)9-14)18(13-26-21)20-11-16-5-3-4-6-19(16)25-20/h3-8,11-15,17H,2,9-10H2,1H3/b22-21-,23-12? |
| InChIKey | GSCPNLAUWXTZAC-XTWJKVAUSA-N |
| XLogP | 4.93 |
| TPSA | 42.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|