C27H28N2O2S — CID 4103059
4-(2,5-dimethoxyphenyl)-N,3-bis(2,3-dimethylphenyl)-1,3-thiazol-2-imine (PubChem CID 4103059) has the molecular formula C27H28N2O2S and a molecular weight of 444.60 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N,3-bis(2,3-dimethylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N,3-bis(2,3-dimethylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4103059 |
| Molecular Formula | C27H28N2O2S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N,3-bis(2,3-dimethylphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3cccc(C)c3C)n2-c2cccc(C)c2C)c1 |
| InChI | InChI=1S/C27H28N2O2S/c1-17-9-7-11-23(19(17)3)28-27-29(24-12-8-10-18(2)20(24)4)25(16-32-27)22-15-21(30-5)13-14-26(22)31-6/h7-16H,1-6H3/b28-27- |
| InChIKey | OXQKPZQFBZNADZ-DQSJHHFOSA-N |
| XLogP | 6.69 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|