C22H24N2O2S — CID 23995723
4-(2,5-dimethoxyphenyl)-N-(2,5-dimethylphenyl)-3-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23995723) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N-(2,5-dimethylphenyl)-3-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N-(2,5-dimethylphenyl)-3-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23995723 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N-(2,5-dimethylphenyl)-3-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CCn1c(-c2cc(OC)ccc2OC)cs/c1=N\c1cc(C)ccc1C |
| InChI | InChI=1S/C22H24N2O2S/c1-6-11-24-20(18-13-17(25-4)9-10-21(18)26-5)14-27-22(24)23-19-12-15(2)7-8-16(19)3/h6-10,12-14H,1,11H2,2-5H3/b23-22- |
| InChIKey | UGKARDQRIJMUGF-FCQUAONHSA-N |
| XLogP | 5.27 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|