C18H20N2S2 — CID 23736772
N-(2,3-dimethylphenyl)-3-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine (PubChem CID 23736772) has the molecular formula C18H20N2S2 and a molecular weight of 328.51 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-3-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine.
| Compound Name | N-(2,3-dimethylphenyl)-3-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23736772 |
| Molecular Formula | C18H20N2S2 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-(2,3-dimethylphenyl)-3-propan-2-yl-4-thiophen-2-yl-1,3-thiazol-2-imine |
| SMILES | Cc1cccc(/N=c2\scc(-c3cccs3)n2C(C)C)c1C |
| InChI | InChI=1S/C18H20N2S2/c1-12(2)20-16(17-9-6-10-21-17)11-22-18(20)19-15-8-5-7-13(3)14(15)4/h5-12H,1-4H3/b19-18- |
| InChIKey | IZQBZJBILICDCI-HNENSFHCSA-N |
| XLogP | 5.71 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|