C24H23F2N5O2S — CID 2378657
4-[[4-[4-(difluoromethoxy)phenyl]-2-(2-morpholin-4-ylethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile (PubChem CID 2378657) has the molecular formula C24H23F2N5O2S and a molecular weight of 483.54 g/mol. Its IUPAC name is 4-[[4-[4-(difluoromethoxy)phenyl]-2-(2-morpholin-4-ylethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile.
| Compound Name | 4-[[4-[4-(difluoromethoxy)phenyl]-2-(2-morpholin-4-ylethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
|---|---|
| PubChem CID | 2378657 |
| Molecular Formula | C24H23F2N5O2S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 4-[[4-[4-(difluoromethoxy)phenyl]-2-(2-morpholin-4-ylethylimino)-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| SMILES | N#Cc1ccc(C=Nn2c(-c3ccc(OC(F)F)cc3)cs/c2=N\CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C24H23F2N5O2S/c25-23(26)33-21-7-5-20(6-8-21)22-17-34-24(28-9-10-30-11-13-32-14-12-30)31(22)29-16-19-3-1-18(15-27)2-4-19/h1-8,16-17,23H,9-14H2/b28-24-,29-16? |
| InChIKey | CQMATPPDMXZDLV-SYGQDELFSA-N |
| XLogP | 3.80 |
| TPSA | 75.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|