C24H27N5O4S — CID 29439387
2-hydroxy-5-[2-(2-methoxyethylimino)-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-4-yl]benzamide (PubChem CID 29439387) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is 2-hydroxy-5-[2-(2-methoxyethylimino)-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-4-yl]benzamide.
| Compound Name | 2-hydroxy-5-[2-(2-methoxyethylimino)-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 29439387 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 2-hydroxy-5-[2-(2-methoxyethylimino)-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]-1,3-thiazol-4-yl]benzamide |
| SMILES | COCC/N=c1\scc(-c2ccc(O)c(C(N)=O)c2)n1/N=C\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H27N5O4S/c1-32-11-8-26-24-29(21(16-34-24)18-4-7-22(30)20(14-18)23(25)31)27-15-17-2-5-19(6-3-17)28-9-12-33-13-10-28/h2-7,14-16,30H,8-13H2,1H3,(H2,25,31)/b26-24-,27-15- |
| InChIKey | CSEAQAAFNGPQEE-CDEYSKPTSA-N |
| XLogP | 2.29 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|