C22H25N3O3S — CID 23852251
4-(3,4-dimethylphenyl)-N-methyl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23852251) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-N-methyl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(3,4-dimethylphenyl)-N-methyl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23852251 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-N-methyl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(C)c(C)c2)n1N=Cc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C22H25N3O3S/c1-14-7-8-16(9-15(14)2)18-13-29-22(23-3)25(18)24-12-17-10-20(27-5)21(28-6)11-19(17)26-4/h7-13H,1-6H3/b23-22-,24-12? |
| InChIKey | GVPXOHPZNJIGLH-GOXAXDAUSA-N |
| XLogP | 4.27 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|