C17H17N3OS2 — CID 23792353
4-(4-methoxyphenyl)-N-methyl-3-[(3-methylthiophen-2-yl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23792353) has the molecular formula C17H17N3OS2 and a molecular weight of 343.48 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N-methyl-3-[(3-methylthiophen-2-yl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-(4-methoxyphenyl)-N-methyl-3-[(3-methylthiophen-2-yl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23792353 |
| Molecular Formula | C17H17N3OS2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 4-(4-methoxyphenyl)-N-methyl-3-[(3-methylthiophen-2-yl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(OC)cc2)n1N=Cc1sccc1C |
| InChI | InChI=1S/C17H17N3OS2/c1-12-8-9-22-16(12)10-19-20-15(11-23-17(20)18-2)13-4-6-14(21-3)7-5-13/h4-11H,1-3H3/b18-17-,19-10? |
| InChIKey | PVIUWXCBZABZMH-OBPOFPIRSA-N |
| XLogP | 4.01 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|