C17H23N3O3S — CID 23989298
4-methyl-N-propan-2-yl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine (PubChem CID 23989298) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-methyl-N-propan-2-yl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine.
| Compound Name | 4-methyl-N-propan-2-yl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23989298 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-methyl-N-propan-2-yl-3-[(2,4,5-trimethoxyphenyl)methylideneamino]-1,3-thiazol-2-imine |
| SMILES | COc1cc(OC)c(OC)cc1C=Nn1c(C)cs/c1=N\C(C)C |
| InChI | InChI=1S/C17H23N3O3S/c1-11(2)19-17-20(12(3)10-24-17)18-9-13-7-15(22-5)16(23-6)8-14(13)21-4/h7-11H,1-6H3/b18-9?,19-17- |
| InChIKey | AMRBVZYXTSXZMH-YGGCKMLOSA-N |
| XLogP | 3.08 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|