C19H23N3S — CID 23739410
3-(cyclohex-3-en-1-ylmethylideneamino)-4-(3,4-dimethylphenyl)-N-methyl-1,3-thiazol-2-imine (PubChem CID 23739410) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is 3-(cyclohex-3-en-1-ylmethylideneamino)-4-(3,4-dimethylphenyl)-N-methyl-1,3-thiazol-2-imine.
| Compound Name | 3-(cyclohex-3-en-1-ylmethylideneamino)-4-(3,4-dimethylphenyl)-N-methyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23739410 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 3-(cyclohex-3-en-1-ylmethylideneamino)-4-(3,4-dimethylphenyl)-N-methyl-1,3-thiazol-2-imine |
| SMILES | C/N=c1\scc(-c2ccc(C)c(C)c2)n1N=CC1CC=CCC1 |
| InChI | InChI=1S/C19H23N3S/c1-14-9-10-17(11-15(14)2)18-13-23-19(20-3)22(18)21-12-16-7-5-4-6-8-16/h4-5,9-13,16H,6-8H2,1-3H3/b20-19-,21-12? |
| InChIKey | QLZLWQNBLBRLFB-RGEOQQOISA-N |
| XLogP | 4.55 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|