C24H20Cl2N4O2S — CID 23826283
6-[3-(cyclohex-3-en-1-ylmethylideneamino)-2-(2,4-dichlorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 23826283) has the molecular formula C24H20Cl2N4O2S and a molecular weight of 499.42 g/mol. Its IUPAC name is 6-[3-(cyclohex-3-en-1-ylmethylideneamino)-2-(2,4-dichlorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[3-(cyclohex-3-en-1-ylmethylideneamino)-2-(2,4-dichlorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 23826283 |
| Molecular Formula | C24H20Cl2N4O2S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 6-[3-(cyclohex-3-en-1-ylmethylideneamino)-2-(2,4-dichlorophenyl)imino-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3cs/c(=N\c4ccc(Cl)cc4Cl)n3N=CC3CC=CCC3)cc2N1 |
| InChI | InChI=1S/C24H20Cl2N4O2S/c25-17-7-8-19(18(26)11-17)29-24-30(27-12-15-4-2-1-3-5-15)21(14-33-24)16-6-9-22-20(10-16)28-23(31)13-32-22/h1-2,6-12,14-15H,3-5,13H2,(H,28,31)/b27-12?,29-24- |
| InChIKey | GAXLOXZKVKLHOU-IIUCLKBUSA-N |
| XLogP | 6.28 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|