C8H7BrN4OS — CID 5412794
4-[(Z)-(5-bromofuran-2-yl)methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 5412794) has the molecular formula C8H7BrN4OS and a molecular weight of 287.14 g/mol. Its IUPAC name is 4-[(Z)-(5-bromofuran-2-yl)methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(5-bromofuran-2-yl)methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 5412794 |
| Molecular Formula | C8H7BrN4OS |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | 4-[(Z)-(5-bromofuran-2-yl)methylideneamino]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1/N=C\c1ccc(Br)o1 |
| InChI | InChI=1S/C8H7BrN4OS/c1-5-11-12-8(15)13(5)10-4-6-2-3-7(9)14-6/h2-4H,1H3,(H,12,15)/b10-4- |
| InChIKey | IWZWTEHTDRSERZ-WMZJFQQLSA-N |
| XLogP | 2.49 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|