C24H18ClN3S — CID 93005804
4-(4-chlorophenyl)-5-phenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-thiazol-2-amine (PubChem CID 93005804) has the molecular formula C24H18ClN3S and a molecular weight of 415.95 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-5-phenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-5-phenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 93005804 |
| Molecular Formula | C24H18ClN3S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-(4-chlorophenyl)-5-phenyl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2nc(N/N=C\C=C\c3ccccc3)sc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18ClN3S/c25-21-15-13-19(14-16-21)22-23(20-11-5-2-6-12-20)29-24(27-22)28-26-17-7-10-18-8-3-1-4-9-18/h1-17H,(H,27,28)/b10-7+,26-17- |
| InChIKey | GXGSOKGIDNTLDT-JXJIOSSYSA-N |
| XLogP | 7.24 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|