C29H21Cl2N3OS — CID 17135045
5-(4-chlorophenyl)-N-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 17135045) has the molecular formula C29H21Cl2N3OS and a molecular weight of 530.48 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | 5-(4-chlorophenyl)-N-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 17135045 |
| Molecular Formula | C29H21Cl2N3OS |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(E)-[4-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2sc(N/N=C/c3ccc(OCc4ccccc4Cl)cc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21Cl2N3OS/c30-24-14-12-22(13-15-24)28-27(21-6-2-1-3-7-21)33-29(36-28)34-32-18-20-10-16-25(17-11-20)35-19-23-8-4-5-9-26(23)31/h1-18H,19H2,(H,33,34)/b32-18+ |
| InChIKey | YKYRIPPRNZEDDF-KCSSXMTESA-N |
| XLogP | 8.81 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|