C17H17N5O2S — CID 28848223
4-(1,4-diazepan-1-yl)-5-(3-nitrophenyl)thieno[2,3-d]pyrimidine (PubChem CID 28848223) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-5-(3-nitrophenyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-(1,4-diazepan-1-yl)-5-(3-nitrophenyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 28848223 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-5-(3-nitrophenyl)thieno[2,3-d]pyrimidine |
| SMILES | O=[N+]([O-])c1cccc(-c2csc3ncnc(N4CCCNCC4)c23)c1 |
| InChI | InChI=1S/C17H17N5O2S/c23-22(24)13-4-1-3-12(9-13)14-10-25-17-15(14)16(19-11-20-17)21-7-2-5-18-6-8-21/h1,3-4,9-11,18H,2,5-8H2 |
| InChIKey | PJCMHSPFDOATMS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|