C15H13N3O3S — CID 709174
5-(3-nitrophenyl)-3-propylthieno[2,3-d]pyrimidin-4-one (PubChem CID 709174) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-3-propylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(3-nitrophenyl)-3-propylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 709174 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-(3-nitrophenyl)-3-propylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCn1cnc2scc(-c3cccc([N+](=O)[O-])c3)c2c1=O |
| InChI | InChI=1S/C15H13N3O3S/c1-2-6-17-9-16-14-13(15(17)19)12(8-22-14)10-4-3-5-11(7-10)18(20)21/h3-5,7-9H,2,6H2,1H3 |
| InChIKey | LXQQBZVLEAWDTH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|