C20H12ClFN4O4S — CID 1182114
N-(3-chloro-4-fluorophenyl)-2-[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 1182114) has the molecular formula C20H12ClFN4O4S and a molecular weight of 458.86 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 1182114 |
| Molecular Formula | C20H12ClFN4O4S |
| Molecular Weight | 458.86 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | O=C(Cn1cnc2scc(-c3cccc([N+](=O)[O-])c3)c2c1=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H12ClFN4O4S/c21-15-7-12(4-5-16(15)22)24-17(27)8-25-10-23-19-18(20(25)28)14(9-31-19)11-2-1-3-13(6-11)26(29)30/h1-7,9-10H,8H2,(H,24,27) |
| InChIKey | GUZIEFXIHWQLPI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|