C24H27N3O5S — CID 40915700
(4-tert-butylcyclohexyl) 2-[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetate (PubChem CID 40915700) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 2-[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetate.
| Compound Name | (4-tert-butylcyclohexyl) 2-[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetate |
|---|---|
| PubChem CID | 40915700 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (4-tert-butylcyclohexyl) 2-[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]acetate |
| SMILES | CC(C)(C)C1CCC(OC(=O)Cn2cnc3scc(-c4cccc([N+](=O)[O-])c4)c3c2=O)CC1 |
| InChI | InChI=1S/C24H27N3O5S/c1-24(2,3)16-7-9-18(10-8-16)32-20(28)12-26-14-25-22-21(23(26)29)19(13-33-22)15-5-4-6-17(11-15)27(30)31/h4-6,11,13-14,16,18H,7-10,12H2,1-3H3 |
| InChIKey | NMHYCHDWPZOYFE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|