C20H20N2O3S — CID 1075278
cyclohexyl 2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetate (PubChem CID 1075278) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is cyclohexyl 2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetate.
| Compound Name | cyclohexyl 2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetate |
|---|---|
| PubChem CID | 1075278 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | cyclohexyl 2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)acetate |
| SMILES | O=C(Cn1cnc2scc(-c3ccccc3)c2c1=O)OC1CCCCC1 |
| InChI | InChI=1S/C20H20N2O3S/c23-17(25-15-9-5-2-6-10-15)11-22-13-21-19-18(20(22)24)16(12-26-19)14-7-3-1-4-8-14/h1,3-4,7-8,12-13,15H,2,5-6,9-11H2 |
| InChIKey | HQRCEAUGNVRDJL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |