C23H19N3O5S — CID 40842662
propan-2-yl 3-[[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]methyl]benzoate (PubChem CID 40842662) has the molecular formula C23H19N3O5S and a molecular weight of 449.49 g/mol. Its IUPAC name is propan-2-yl 3-[[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]methyl]benzoate.
| Compound Name | propan-2-yl 3-[[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 40842662 |
| Molecular Formula | C23H19N3O5S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | propan-2-yl 3-[[5-(3-nitrophenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]methyl]benzoate |
| SMILES | CC(C)OC(=O)c1cccc(Cn2cnc3scc(-c4cccc([N+](=O)[O-])c4)c3c2=O)c1 |
| InChI | InChI=1S/C23H19N3O5S/c1-14(2)31-23(28)17-7-3-5-15(9-17)11-25-13-24-21-20(22(25)27)19(12-32-21)16-6-4-8-18(10-16)26(29)30/h3-10,12-14H,11H2,1-2H3 |
| InChIKey | SSFOJVLAFAVLKD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|