C16H16N2OS — CID 709146
5-(4-methylphenyl)-3-propylthieno[2,3-d]pyrimidin-4-one (PubChem CID 709146) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3-propylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-methylphenyl)-3-propylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 709146 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 5-(4-methylphenyl)-3-propylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCCn1cnc2scc(-c3ccc(C)cc3)c2c1=O |
| InChI | InChI=1S/C16H16N2OS/c1-3-8-18-10-17-15-14(16(18)19)13(9-20-15)12-6-4-11(2)5-7-12/h4-7,9-10H,3,8H2,1-2H3 |
| InChIKey | KBABMKGUAZSBSM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |