C17H14Cl2N2OS — CID 16619367
3-[(2,2-dichlorocyclopropyl)methyl]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one (PubChem CID 16619367) has the molecular formula C17H14Cl2N2OS and a molecular weight of 365.29 g/mol. Its IUPAC name is 3-[(2,2-dichlorocyclopropyl)methyl]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(2,2-dichlorocyclopropyl)methyl]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 16619367 |
| Molecular Formula | C17H14Cl2N2OS |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 3-[(2,2-dichlorocyclopropyl)methyl]-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2csc3ncn(CC4CC4(Cl)Cl)c(=O)c23)cc1 |
| InChI | InChI=1S/C17H14Cl2N2OS/c1-10-2-4-11(5-3-10)13-8-23-15-14(13)16(22)21(9-20-15)7-12-6-17(12,18)19/h2-5,8-9,12H,6-7H2,1H3 |
| InChIKey | NYMLKFRIOGBXSI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|