C16H12Cl2N2OS — CID 9353564
3-[[(1S)-2,2-dichlorocyclopropyl]methyl]-5-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 9353564) has the molecular formula C16H12Cl2N2OS and a molecular weight of 351.26 g/mol. Its IUPAC name is 3-[[(1S)-2,2-dichlorocyclopropyl]methyl]-5-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[[(1S)-2,2-dichlorocyclopropyl]methyl]-5-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 9353564 |
| Molecular Formula | C16H12Cl2N2OS |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 3-[[(1S)-2,2-dichlorocyclopropyl]methyl]-5-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(-c3ccccc3)csc2ncn1C[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C16H12Cl2N2OS/c17-16(18)6-11(16)7-20-9-19-14-13(15(20)21)12(8-22-14)10-4-2-1-3-5-10/h1-5,8-9,11H,6-7H2/t11-/m0/s1 |
| InChIKey | SDRZLYFILRGPLU-NSHDSACASA-N |
| XLogP | 4.32 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|