C20H16N2O4S2 — CID 24526106
phenyl 2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)ethanesulfonate (PubChem CID 24526106) has the molecular formula C20H16N2O4S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is phenyl 2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)ethanesulfonate.
| Compound Name | phenyl 2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)ethanesulfonate |
|---|---|
| PubChem CID | 24526106 |
| Molecular Formula | C20H16N2O4S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | phenyl 2-(4-oxo-5-phenylthieno[2,3-d]pyrimidin-3-yl)ethanesulfonate |
| SMILES | O=c1c2c(-c3ccccc3)csc2ncn1CCS(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H16N2O4S2/c23-20-18-17(15-7-3-1-4-8-15)13-27-19(18)21-14-22(20)11-12-28(24,25)26-16-9-5-2-6-10-16/h1-10,13-14H,11-12H2 |
| InChIKey | FIWCWUYOLOHOIB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|