C22H18N2O3S — CID 7708384
5-(4-ethoxyphenyl)-3-phenacylthieno[2,3-d]pyrimidin-4-one (PubChem CID 7708384) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-3-phenacylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-ethoxyphenyl)-3-phenacylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7708384 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 5-(4-ethoxyphenyl)-3-phenacylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1ccc(-c2csc3ncn(CC(=O)c4ccccc4)c(=O)c23)cc1 |
| InChI | InChI=1S/C22H18N2O3S/c1-2-27-17-10-8-15(9-11-17)18-13-28-21-20(18)22(26)24(14-23-21)12-19(25)16-6-4-3-5-7-16/h3-11,13-14H,2,12H2,1H3 |
| InChIKey | XGYMGZLQDDWCMQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |