About 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one
5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 20999134) has the molecular formula C28H22N2O2S
and a molecular weight of 450.56 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 20999134 |
| Molecular Formula | C28H22N2O2S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2csc3ncn(CC(=O)c4ccc(-c5ccccc5)cc4)c(=O)c23)cc1C |
| InChI | InChI=1S/C28H22N2O2S/c1-18-8-9-23(14-19(18)2)24-16-33-27-26(24)28(32)30(17-29-27)15-25(31)22-12-10-21(11-13-22)20-6-4-3-5-7-20/h3-14,16-17H,15H2,1-2H3 |
| InChIKey | RVQVTSNWTJAWHN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one (CID 20999134) is 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one is Cc1ccc(-c2csc3ncn(CC(=O)c4ccc(-c5ccccc5)cc4)c(=O)c23)cc1C.
What is the InChIKey of 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one?
The InChIKey is RVQVTSNWTJAWHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22N2O2S/c1-18-8-9-23(14-19(18)2)24-16-33-27-26(24)28(32)30(17-29-27)15-25(31)22-12-10-21(11-13-22)20-6-4-3-5-7-20/h3-14,16-17H,15H2,1-2H3.
What are the key properties of 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one?
5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one has a molecular weight of 450.56 g/mol, XLogP of 6.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethylphenyl)-3-[2-oxo-2-(4-phenylphenyl)ethyl]thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 20999134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).