C24H22N4O2S — CID 118712225
4-(4-benzylpiperidin-1-yl)-5-(4-nitrophenyl)thieno[2,3-d]pyrimidine (PubChem CID 118712225) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-(4-benzylpiperidin-1-yl)-5-(4-nitrophenyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-(4-benzylpiperidin-1-yl)-5-(4-nitrophenyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 118712225 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-(4-benzylpiperidin-1-yl)-5-(4-nitrophenyl)thieno[2,3-d]pyrimidine |
| SMILES | O=[N+]([O-])c1ccc(-c2csc3ncnc(N4CCC(Cc5ccccc5)CC4)c23)cc1 |
| InChI | InChI=1S/C24H22N4O2S/c29-28(30)20-8-6-19(7-9-20)21-15-31-24-22(21)23(25-16-26-24)27-12-10-18(11-13-27)14-17-4-2-1-3-5-17/h1-9,15-16,18H,10-14H2 |
| InChIKey | KNBUKZWOXRSVHG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|