C19H14N4O3S — CID 9111798
4-[(6-methyl-2-nitro-3-pyridinyl)oxy]-5-(4-methylphenyl)thieno[2,3-d]pyrimidine (PubChem CID 9111798) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is 4-[(6-methyl-2-nitro-3-pyridinyl)oxy]-5-(4-methylphenyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[(6-methyl-2-nitro-3-pyridinyl)oxy]-5-(4-methylphenyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 9111798 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-[(6-methyl-2-nitro-3-pyridinyl)oxy]-5-(4-methylphenyl)thieno[2,3-d]pyrimidine |
| SMILES | Cc1ccc(-c2csc3ncnc(Oc4ccc(C)nc4[N+](=O)[O-])c23)cc1 |
| InChI | InChI=1S/C19H14N4O3S/c1-11-3-6-13(7-4-11)14-9-27-19-16(14)18(20-10-21-19)26-15-8-5-12(2)22-17(15)23(24)25/h3-10H,1-2H3 |
| InChIKey | YTYLNGAREFUGFY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|