C22H13N5O3S — CID 26451845
4-[(2-nitro-3-pyridinyl)oxy]-5-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidine (PubChem CID 26451845) has the molecular formula C22H13N5O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is 4-[(2-nitro-3-pyridinyl)oxy]-5-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidine.
| Compound Name | 4-[(2-nitro-3-pyridinyl)oxy]-5-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 26451845 |
| Molecular Formula | C22H13N5O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 4-[(2-nitro-3-pyridinyl)oxy]-5-phenyl-2-pyridin-3-ylthieno[2,3-d]pyrimidine |
| SMILES | O=[N+]([O-])c1ncccc1Oc1nc(-c2cccnc2)nc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C22H13N5O3S/c28-27(29)20-17(9-5-11-24-20)30-21-18-16(14-6-2-1-3-7-14)13-31-22(18)26-19(25-21)15-8-4-10-23-12-15/h1-13H |
| InChIKey | VLGOSHYJMWKKDW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 103.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|