C20H17BrN4OS — CID 133279161
1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine (PubChem CID 133279161) has the molecular formula C20H17BrN4OS and a molecular weight of 441.35 g/mol. Its IUPAC name is 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 133279161 |
| Molecular Formula | C20H17BrN4OS |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1nc(Oc2cccnc2Br)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C20H17BrN4OS/c1-25(2)11-16-23-19(26-15-9-6-10-22-18(15)21)17-14(12-27-20(17)24-16)13-7-4-3-5-8-13/h3-10,12H,11H2,1-2H3 |
| InChIKey | PMYAZUHFLRMINM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|