About 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine
1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine (PubChem CID 133279161) has the molecular formula C20H17BrN4OS
and a molecular weight of 441.35 g/mol. Its IUPAC name is 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine |
| PubChem CID | 133279161 |
| Molecular Formula | C20H17BrN4OS |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1nc(Oc2cccnc2Br)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C20H17BrN4OS/c1-25(2)11-16-23-19(26-15-9-6-10-22-18(15)21)17-14(12-27-20(17)24-16)13-7-4-3-5-8-13/h3-10,12H,11H2,1-2H3 |
| InChIKey | PMYAZUHFLRMINM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine (CID 133279161) is 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine is CN(C)Cc1nc(Oc2cccnc2Br)c2c(-c3ccccc3)csc2n1.
What is the InChIKey of 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine?
The InChIKey is PMYAZUHFLRMINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17BrN4OS/c1-25(2)11-16-23-19(26-15-9-6-10-22-18(15)21)17-14(12-27-20(17)24-16)13-7-4-3-5-8-13/h3-10,12H,11H2,1-2H3.
What are the key properties of 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine?
1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine has a molecular weight of 441.35 g/mol, XLogP of 5.37, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(2-bromo-3-pyridinyl)oxy]-5-phenylthieno[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanamine is sourced from PubChem (CID 133279161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).