C18H22N4S2 — CID 133278781
2-[(dimethylamino)methyl]-N-(2-methylsulfanylethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 133278781) has the molecular formula C18H22N4S2 and a molecular weight of 358.54 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-N-(2-methylsulfanylethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-[(dimethylamino)methyl]-N-(2-methylsulfanylethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133278781 |
| Molecular Formula | C18H22N4S2 |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-[(dimethylamino)methyl]-N-(2-methylsulfanylethyl)-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CSCCNc1nc(CN(C)C)nc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H22N4S2/c1-22(2)11-15-20-17(19-9-10-23-3)16-14(12-24-18(16)21-15)13-7-5-4-6-8-13/h4-8,12H,9-11H2,1-3H3,(H,19,20,21) |
| InChIKey | UABXFQOIYYFMGP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|