C20H22N4S — CID 133362238
N-cyclopent-3-en-1-yl-2-[(dimethylamino)methyl]-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 133362238) has the molecular formula C20H22N4S and a molecular weight of 350.49 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-2-[(dimethylamino)methyl]-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-cyclopent-3-en-1-yl-2-[(dimethylamino)methyl]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133362238 |
| Molecular Formula | C20H22N4S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-cyclopent-3-en-1-yl-2-[(dimethylamino)methyl]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CN(C)Cc1nc(NC2CC=CC2)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C20H22N4S/c1-24(2)12-17-22-19(21-15-10-6-7-11-15)18-16(13-25-20(18)23-17)14-8-4-3-5-9-14/h3-9,13,15H,10-12H2,1-2H3,(H,21,22,23) |
| InChIKey | SPXJNXLIDYGQFY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|