C19H14BrN3O2S — CID 133279160
4-[(2-bromo-3-pyridinyl)oxy]-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine (PubChem CID 133279160) has the molecular formula C19H14BrN3O2S and a molecular weight of 428.31 g/mol. Its IUPAC name is 4-[(2-bromo-3-pyridinyl)oxy]-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine.
| Compound Name | 4-[(2-bromo-3-pyridinyl)oxy]-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 133279160 |
| Molecular Formula | C19H14BrN3O2S |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 4-[(2-bromo-3-pyridinyl)oxy]-2-(methoxymethyl)-5-phenylthieno[2,3-d]pyrimidine |
| SMILES | COCc1nc(Oc2cccnc2Br)c2c(-c3ccccc3)csc2n1 |
| InChI | InChI=1S/C19H14BrN3O2S/c1-24-10-15-22-18(25-14-8-5-9-21-17(14)20)16-13(11-26-19(16)23-15)12-6-3-2-4-7-12/h2-9,11H,10H2,1H3 |
| InChIKey | AWTOVVFIEMDORG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|