C19H12N2O2S — CID 4737873
4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzaldehyde (PubChem CID 4737873) has the molecular formula C19H12N2O2S and a molecular weight of 332.38 g/mol. Its IUPAC name is 4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzaldehyde.
| Compound Name | 4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzaldehyde |
|---|---|
| PubChem CID | 4737873 |
| Molecular Formula | C19H12N2O2S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)oxybenzaldehyde |
| SMILES | O=Cc1ccc(Oc2ncnc3scc(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C19H12N2O2S/c22-10-13-6-8-15(9-7-13)23-18-17-16(14-4-2-1-3-5-14)11-24-19(17)21-12-20-18/h1-12H |
| InChIKey | BIWVWXYGBWLGAT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|