C20H18N4O2S2 — CID 175315699
4-[1-amino-1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)ethyl]benzenesulfonamide (PubChem CID 175315699) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[1-amino-1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-[1-amino-1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175315699 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 4-[1-amino-1-(5-phenylthieno[2,3-d]pyrimidin-4-yl)ethyl]benzenesulfonamide |
| SMILES | CC(N)(c1ccc(S(N)(=O)=O)cc1)c1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H18N4O2S2/c1-20(21,14-7-9-15(10-8-14)28(22,25)26)18-17-16(13-5-3-2-4-6-13)11-27-19(17)24-12-23-18/h2-12H,21H2,1H3,(H2,22,25,26) |
| InChIKey | ZSBBIVVBYNYYCT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |