C22H21N3OS2 — CID 90051604
6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine (PubChem CID 90051604) has the molecular formula C22H21N3OS2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine.
| Compound Name | 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 90051604 |
| Molecular Formula | C22H21N3OS2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine |
| SMILES | CCCCS(=O)c1sc2nc(-c3ccccc3)nc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C22H21N3OS2/c1-2-3-14-28(26)22-18(23)17-19(15-10-6-4-7-11-15)24-20(25-21(17)27-22)16-12-8-5-9-13-16/h4-13H,2-3,14,23H2,1H3 |
| InChIKey | GCZFXDLEQAGNAQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |