About 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine
6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine (PubChem CID 90051604) has the molecular formula C22H21N3OS2
and a molecular weight of 407.56 g/mol. Its IUPAC name is 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine |
| PubChem CID | 90051604 |
| Molecular Formula | C22H21N3OS2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine |
| SMILES | CCCCS(=O)c1sc2nc(-c3ccccc3)nc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C22H21N3OS2/c1-2-3-14-28(26)22-18(23)17-19(15-10-6-4-7-11-15)24-20(25-21(17)27-22)16-12-8-5-9-13-16/h4-13H,2-3,14,23H2,1H3 |
| InChIKey | GCZFXDLEQAGNAQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine?
The IUPAC name of 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine (CID 90051604) is 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine.
What is the SMILES notation for 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine?
The canonical SMILES for 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine is CCCCS(=O)c1sc2nc(-c3ccccc3)nc(-c3ccccc3)c2c1N.
What is the InChIKey of 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine?
The InChIKey is GCZFXDLEQAGNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3OS2/c1-2-3-14-28(26)22-18(23)17-19(15-10-6-4-7-11-15)24-20(25-21(17)27-22)16-12-8-5-9-13-16/h4-13H,2-3,14,23H2,1H3.
What are the key properties of 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine?
6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine has a molecular weight of 407.56 g/mol, XLogP of 5.52, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butylsulfinyl-2,4-diphenylthieno[2,3-d]pyrimidin-5-amine is sourced from PubChem (CID 90051604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).