C15H15ClN4S — CID 28850288
N'-[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]propane-1,3-diamine (PubChem CID 28850288) has the molecular formula C15H15ClN4S and a molecular weight of 318.83 g/mol. Its IUPAC name is N'-[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]propane-1,3-diamine.
| Compound Name | N'-[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 28850288 |
| Molecular Formula | C15H15ClN4S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N'-[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]propane-1,3-diamine |
| SMILES | NCCCNc1ncnc2scc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C15H15ClN4S/c16-11-4-2-10(3-5-11)12-8-21-15-13(12)14(19-9-20-15)18-7-1-6-17/h2-5,8-9H,1,6-7,17H2,(H,18,19,20) |
| InChIKey | PIBYLYFGMPAUDZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|