C26H27FN4O3S — CID 21010321
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 21010321) has the molecular formula C26H27FN4O3S and a molecular weight of 494.59 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 21010321 |
| Molecular Formula | C26H27FN4O3S |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1Nc1ncnc2scc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C26H27FN4O3S/c1-3-33-22-14-21(31-9-11-32-12-10-31)23(34-4-2)13-20(22)30-25-24-19(15-35-26(24)29-16-28-25)17-5-7-18(27)8-6-17/h5-8,13-16H,3-4,9-12H2,1-2H3,(H,28,29,30) |
| InChIKey | XLVJNXGNIYBCGK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|